CAS 455267-56-8 appears in our catalog under these names: 2-(2-Fluorophenyl)cyclopropanecarboxylic acid, 95%, 2–(2–Fluorophenyl)cyclopropanecarboxylic Acid, 2-(2-Fluorophenyl)cyclopropanecarboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,5g.
2-(2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 455267-56-8) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 2-(2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: OLDXGEXZLWOGJN-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 2-(2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | OLDXGEXZLWOGJN-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)