CAS 773130-21-5 appears in our catalog under these names: 2-Fluoro-5-methylcinnamic acid, 95%, 2-Fluoro-5-methylcinnamic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(E)-3-(2-fluoro-5-methylphenyl)prop-2-enoic acid (CAS 773130-21-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: (E)-3-(2-fluoro-5-methylphenyl)prop-2-enoic acid. InChIKey: GSGMKJZHPGZBNY-HWKANZROSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | (E)-3-(2-fluoro-5-methylphenyl)prop-2-enoic acid |
| InChIKey | GSGMKJZHPGZBNY-HWKANZROSA-N |
| SMILES | CC1=CC(=C(C=C1)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)