Products 1247927-81-6
CAS 1247927-81-6 appears in our catalog under these names: 4-Cyclopropyl-2-fluorobenzoic acid, 97%, 4-cyclopropyl-2-fluorobenzoic acid, 4-Cyclopropyl-2-fluorobenzoic acid 98%, 4-Cyclopropyl-2-fluorobenzoic acid, 98%, 98%, 4-CYCLOPROPYL-2-FLUOROBENZOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 100mg, 500mg.
4-cyclopropyl-2-fluorobenzoic acid (CAS 1247927-81-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-cyclopropyl-2-fluorobenzoic acid. InChIKey: UPYZCTDSUYXKBG-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluorobenzoic acid |
| InChIKey | UPYZCTDSUYXKBG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)