CAS 628732-07-0 appears in our catalog under these names: 5-Fluoro-2,3-dihydro-1H-indene-2-carboxylic acid, 98%, 5-Fluoro-2,3-dihydro-1H-indene-2-carboxylic acid 97%, 5-Fluoro-2,3-dihydro-1H-indene-2-carboxylic acid, 97%, 97%, 5-Fluoro-2,3-dihydro-1H-indene-2-carboxylic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-fluoro-2,3-dihydro-1H-indene-2-carboxylic acid (CAS 628732-07-0) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1H-indene-2-carboxylic acid. InChIKey: JPFRESMYTROPCF-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1H-indene-2-carboxylic acid |
| InChIKey | JPFRESMYTROPCF-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)