4-Chloro-2-(trifluoromethoxy)benzoic acid, 98%
cas: 1261605-70-2 — see every product listed under this CAS number, including other names
4-Chloro-2-(trifluoromethoxy)benzoic acid, 98% (CAS 1261605-70-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A653685-1g |
| cas | 1261605-70-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 882.12 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Ambeed | 25g | 2545.31 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1168.40 Pln | |
| Chemat | 10g | 2147.60 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 941.92 Pln | |
| BLDpharm | 10g | 1713.87 Pln | |
| BLDpharm | 25g | 2741.28 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2-(trifluoromethoxy)benzoic acid (CAS 1261605-70-2) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 4-chloro-2-(trifluoromethoxy)benzoic acid. InChIKey: SSORZLDIKSZDTH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethoxy)benzoic acid |
| InChIKey | SSORZLDIKSZDTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)