cas: 1430237-54-9 — see every product listed under this CAS number, including other names
4-Chloro-3-(hydroxymethyl)phenylboronic acid, ≥95%, ≥95% (CAS 1430237-54-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWS3-250mg |
| cas | 1430237-54-9 |
| size | 250mg |
| availability | 2.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 3789.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[4-chloro-3-(hydroxymethyl)phenyl]boronic acid (CAS 1430237-54-9) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: [4-chloro-3-(hydroxymethyl)phenyl]boronic acid. InChIKey: QYYROAZVVUGRER-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | [4-chloro-3-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | QYYROAZVVUGRER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CO)(O)O |
Computed by PubChem (NCBI)