4-Chloro-3-(trifluoromethoxy)benzoic acid, 98%
cas: 886500-50-1 — see every product listed under this CAS number, including other names
4-Chloro-3-(trifluoromethoxy)benzoic acid, 98% (CAS 886500-50-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g, 100g, 1g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F037610-250MG |
| cas | 886500-50-1 |
| size | 250mg |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 25g | 2023.26 Pln | |
| Fluorochem | 100g | 6771.59 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 570.62 Pln | |
| Ambeed | 25g | 1972.38 Pln | |
| Ambeed | 100g | 6756.12 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 10g | 803.60 Pln | |
| Chemat | 25g | 1557.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
4-chloro-3-(trifluoromethoxy)benzoic acid (CAS 886500-50-1) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 4-chloro-3-(trifluoromethoxy)benzoic acid. InChIKey: GTBBHPFHWDVWMS-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethoxy)benzoic acid |
| InChIKey | GTBBHPFHWDVWMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)