cas: 177787-25-6 — see every product listed under this CAS number, including other names
4-Chloro-3-fluorobenzoyl chloride 95% (CAS 177787-25-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372872-250mg |
| cas | 177787-25-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 292.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A372872 |
4-chloro-3-fluorobenzoyl chloride (CAS 177787-25-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 4-chloro-3-fluorobenzoyl chloride. InChIKey: HJMGUKOEVZJUAO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 4-chloro-3-fluorobenzoyl chloride |
| InChIKey | HJMGUKOEVZJUAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)F)Cl |
Computed by PubChem (NCBI)