4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine, 98%
cas: 1245645-97-9 — see every product listed under this CAS number, including other names
4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine, 98% (CAS 1245645-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A742746-100mg |
| cas | 1245645-97-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1393.88 Pln | |
| Ambeed | 5g | 4047.19 Pln | |
| Ambeed | 10g | 6694.94 Pln | |
| Ambeed | 25g | 13319.88 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 542.06 Pln | |
| BLDpharm | 1g | 1497.28 Pln | |
| BLDpharm | 5g | 4362.93 Pln | |
| BLDpharm | 10g | 7211.93 Pln | |
| BLDpharm | 25g | 14359.41 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1245645-97-9) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: WOFUUJSVPQZPIH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | WOFUUJSVPQZPIH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
![4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine, 96%](https://cdn.chemat.com.pl/products/images/4ea15386117b841918eb03a7b22c5fbb2e60a236b24b048cb2931630d185ada8.svg)