CAS 1245645-97-9 appears in our catalog under these names: 4-Chloro-5-Nitro-1H-Pyrrolo[2,3-B]Pyridine, 97%, 97%, 4-Chloro-5-nitro-1h-pyrrolo[2,3-b]pyridine, 95%, 4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine, 96%. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1245645-97-9) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: WOFUUJSVPQZPIH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 4-chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | WOFUUJSVPQZPIH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)