cas: 214470-55-0 — see every product listed under this CAS number, including other names
4-Chloro-6,7-dimethoxy-quinoline-3-carbonitrile, 95% (CAS 214470-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049103-100MG |
| cas | 214470-55-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 1g | 1528.65 Pln | |
| Fluorochem | 5g | 4954.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-6,7-dimethoxyquinoline-3-carbonitrile (CAS 214470-55-0) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 4-chloro-6,7-dimethoxyquinoline-3-carbonitrile. InChIKey: HMLOMVBFQJAMCN-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 4-chloro-6,7-dimethoxyquinoline-3-carbonitrile |
| InChIKey | HMLOMVBFQJAMCN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)C#N)Cl)OC |
Computed by PubChem (NCBI)