CAS 921938-96-7 is the registry number for 4-[(6-Methylpyrazin-2-yl)oxy]benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(6-methylpyrazin-2-yl)oxybenzoyl chloride (CAS 921938-96-7) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 4-(6-methylpyrazin-2-yl)oxybenzoyl chloride. InChIKey: HGYASQNSEYDOEQ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 4-(6-methylpyrazin-2-yl)oxybenzoyl chloride |
| InChIKey | HGYASQNSEYDOEQ-UHFFFAOYSA-N |
| SMILES | CC1=CN=CC(=N1)OC2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)