Products 1363382-34-6
CAS 1363382-34-6 appears in our catalog under these names: 3-(4-Chloro-phenyl)-pyrazine-2-carboxylic acid methyl ester, 95%, 3-(4-Chloro-phenyl)-pyrazine-2-carboxylic acid methyl ester, 93%, 93%, 3-(4-CHLORO-PHENYL)-PYRAZINE-2-CARBOXYLIC ACID METHYL ESTER, 93%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
Methyl 3-(4-chlorophenyl)pyrazine-2-carboxylate (CAS 1363382-34-6) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: methyl 3-(4-chlorophenyl)pyrazine-2-carboxylate. InChIKey: HAGPLXHPHTWLHI-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | methyl 3-(4-chlorophenyl)pyrazine-2-carboxylate |
| InChIKey | HAGPLXHPHTWLHI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CN=C1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)