CAS 856995-48-7 is the registry number for Phenacetin Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)imino-(4-hydroxyphenyl)-oxidoazanium (CAS 856995-48-7) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: (4-chlorophenyl)imino-(4-hydroxyphenyl)-oxidoazanium. InChIKey: BSTGGNOXLMUOBR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | (4-chlorophenyl)imino-(4-hydroxyphenyl)-oxidoazanium |
| InChIKey | BSTGGNOXLMUOBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+](C2=CC=C(C=C2)O)[O-])Cl |
Computed by PubChem (NCBI)