Products 1426958-49-7

CAS 1426958-49-7 is the registry number for 6-Amino-5-(4-chlorophenyl)pyridine-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

6-amino-5-(4-chlorophenyl)pyridine-3-carboxylic acid (CAS 1426958-49-7) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 6-amino-5-(4-chlorophenyl)pyridine-3-carboxylic acid. InChIKey: VNVANSXPUFRFST-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClN2O2
Molecular weight248.66 g/mol
IUPAC name6-amino-5-(4-chlorophenyl)pyridine-3-carboxylic acid
InChIKeyVNVANSXPUFRFST-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(N=CC(=C2)C(=O)O)N)Cl

Computed by PubChem (NCBI)