Products 1132825-72-9
CAS 1132825-72-9 is the registry number for Methyl 4-(6-chloropyrimidin-4-yl)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Methyl 4-(6-chloropyrimidin-4-yl)benzoate (CAS 1132825-72-9) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: methyl 4-(6-chloropyrimidin-4-yl)benzoate. InChIKey: UHDUPSOCUBSGDW-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | methyl 4-(6-chloropyrimidin-4-yl)benzoate |
| InChIKey | UHDUPSOCUBSGDW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)