CAS 540512-04-7 appears in our catalog under these names: 4-(4-Chloro-3-nitrobenzyl)pyridine, 95%, 4-(4-Chloro-3-nitrobenzyl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg.
4-[(4-chloro-3-nitrophenyl)methyl]pyridine (CAS 540512-04-7) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 4-[(4-chloro-3-nitrophenyl)methyl]pyridine. InChIKey: XHXNNLKPICIXES-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 4-[(4-chloro-3-nitrophenyl)methyl]pyridine |
| InChIKey | XHXNNLKPICIXES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=CC=NC=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)