cas: 123053-23-6 — see every product listed under this CAS number, including other names
4-Chloro-L-phenylalanine.HCl (CAS 123053-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M01543-1G |
| cas | 123053-23-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 721.64 Pln | |
| Fluorochem | 5g | 2497.06 Pln | |
| Fluorochem | 25g | 6797.62 Pln |
| delivery time | 3-4 weeks |
|---|
(2S)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride (CAS 123053-23-6) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2S)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride. InChIKey: PFOCEDBJFKVRHU-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | PFOCEDBJFKVRHU-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)