Products 23633-07-0
CAS 23633-07-0 appears in our catalog under these names: 2-Amino-3-(4-chlorophenyl)propanoic acid hydrochloride, 95%, Fenclonine hydrochloride, Fenclonine (hydrochloride), 98.60%. Offered by: Combi-blocks, TargetMol, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 25mg, 50mg, 100mg, 250 mg, 500 mg.
2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride (CAS 23633-07-0) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride. InChIKey: PFOCEDBJFKVRHU-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | PFOCEDBJFKVRHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Phenylalanine, 4-chloro-, hydrochloride, Fenclonine Hydrochloride, 2-amino-3-(4-chlorophenyl)propanoic Acid Hydrochloride, 4-Chloro-D-phenylalanine HCl, 2-amino-3-(4-chlorophenyl)propionic acid hydrochloride, FENCLONINE (+/-), orb1737606, (R)-4-chlorophenylalanine HCl Salt, P-CHLOROPHENYLALANINE HYDROCHLORIDE, (R)-4-Chlorophenylalanine Hydrochloride Salt