cas: 354128-89-5 — see every product listed under this CAS number, including other names
4-Chloro-N-cyclopropylbenzenesulfonamide, 98% (CAS 354128-89-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | OT-2194-5g |
| cas | 354128-89-5 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 570.65 Pln | |
| Fluorochem | 5g | 1773.35 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 386.56 Pln | |
| BLDpharm | 5g | 1075.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-chloro-N-cyclopropylbenzenesulfonamide (CAS 354128-89-5) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 4-chloro-N-cyclopropylbenzenesulfonamide. InChIKey: BAOROYZLWUOHLF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 4-chloro-N-cyclopropylbenzenesulfonamide |
| InChIKey | BAOROYZLWUOHLF-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)