Products 54057-59-9
CAS 54057-59-9 appears in our catalog under these names: 4-Cinnamamidobenzoic acid, 97%, 97%, 4-Cinnamamidobenzoic acid, 97%. Offered by: Chemat, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
4-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid (CAS 54057-59-9) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 4-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid. InChIKey: NLLZCFFEAPFEJG-IZZDOVSWSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 4-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
| InChIKey | NLLZCFFEAPFEJG-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-[(1-oxo-3-phenylprop-2-enyl)amino]benzoic acid, 4-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid, 4-(3-phenylacrylamido)benzoic acid, 4-((2E)-3-phenylprop-2-enoylamino)benzoic acid, 4-{[(2E)-3-phenylprop-2-enoyl]amino}benzoic acid, 4-[(1-Oxo-3-phenyl-2-propen-1-yl)amino]benzoic acid, Benzoic acid, 4-[(1-oxo-3-phenyl-2-propen-1-yl)amino]-