4-Cyano-2-fluorobenzene-1-sulfonyl chloride, 95%
cas: 918967-78-9 — see every product listed under this CAS number, including other names
4-Cyano-2-fluorobenzene-1-sulfonyl chloride, 95% (CAS 918967-78-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A592596-250mg |
| cas | 918967-78-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1065.69 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 986.00 Pln | |
| Chemat | 1g | 2406.80 Pln | |
| Chemat | 5g | 6611.60 Pln | |
| Chemat | 10g | 9779.60 Pln | |
| BLDpharm | 100mg | 642.02 Pln | |
| BLDpharm | 250mg | 1141.84 Pln | |
| BLDpharm | 1g | 2707.96 Pln | |
| BLDpharm | 5g | 7789.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-cyano-2-fluorobenzenesulfonyl chloride (CAS 918967-78-9) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 4-cyano-2-fluorobenzenesulfonyl chloride. InChIKey: UYHVZXCIAQVHMY-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 4-cyano-2-fluorobenzenesulfonyl chloride |
| InChIKey | UYHVZXCIAQVHMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)