cas: 1097871-99-2 — see every product listed under this CAS number, including other names
4-Cyano-3-fluorophenylacetic acid, 95%, 95% (CAS 1097871-99-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1102IH-50mg |
| cas | 1097871-99-2 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 242.00 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1322.00 Pln | |
| Chemat | 5g | 4470.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-cyano-3-fluorophenyl)acetic acid (CAS 1097871-99-2) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 2-(4-cyano-3-fluorophenyl)acetic acid. InChIKey: CUYMMXTVNSUGSD-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 2-(4-cyano-3-fluorophenyl)acetic acid |
| InChIKey | CUYMMXTVNSUGSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)C#N |
Computed by PubChem (NCBI)