CAS 908600-73-7 appears in our catalog under these names: 6-Fluoro-1h-indole-5-carboxylic acid, 95%, 6-Fluoroindole-5-carboxylic Acid, 95-<97%, 6-Fluoroindole-5-carboxylic Acid, ≥97-<99%, 1H-Indole-5-carboxylic acid, 6-fluoro, 6-Fluoro-1H-indole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g, 100mg.
6-fluoro-1H-indole-5-carboxylic acid (CAS 908600-73-7) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1H-indole-5-carboxylic acid. InChIKey: MDHOVFSMMFAXIY-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-5-carboxylic acid |
| InChIKey | MDHOVFSMMFAXIY-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)C(=O)O)F |
Computed by PubChem (NCBI)