CAS 749240-57-1 appears in our catalog under these names: 5-Fluoro-7-methyl isatin, 95%, 5-Fluoro-7-methylisatin, 95-<97%, 5-Fluoro-7-methylisatin, ≥97-<99%, 5-Fluoro-7-methylisatin, 98%, 98%, 5-Fluoro-7-methyl-2,3-dihydro-1h-indole-2,3-dione, 98+%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 25g, 50g, 100g.
5-fluoro-7-methyl-1H-indole-2,3-dione (CAS 749240-57-1) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 5-fluoro-7-methyl-1H-indole-2,3-dione. InChIKey: UTQPVTUKUNIWMB-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-fluoro-7-methyl-1H-indole-2,3-dione |
| InChIKey | UTQPVTUKUNIWMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2=O)F |
Computed by PubChem (NCBI)