CAS 1073262-83-5 appears in our catalog under these names: 7-Fluoro-6-methyl isatin, 97%, 7-Fluoro-6-methylindoline-2,3-dione, 95+%, 7-Fluoro-6-methyl isatin, 7-Fluoro-6-methyl isatin, 98%, 98%, 7-Fluoro-6-methylindoline-2,3-dione, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 100mg.
7-fluoro-6-methyl-1H-indole-2,3-dione (CAS 1073262-83-5) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 7-fluoro-6-methyl-1H-indole-2,3-dione. InChIKey: PUJMIHLZTUIWLX-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 7-fluoro-6-methyl-1H-indole-2,3-dione |
| InChIKey | PUJMIHLZTUIWLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C(=O)N2)F |
Computed by PubChem (NCBI)