CAS 773-91-1 appears in our catalog under these names: 5-Fluoro-1-methylindoline-2,3-dione, 95+%, 5-Fluoro-1-methyl-1h-indole-2,3-dione, 95%, 5-Fluoro-1-methylindoline-2,3-dione, >98.0%(GC)(T), 5-Fluoro-1-methylindoline-2,3-dione, 98%, 98%, 5-fluoro-1-methyl-1H-indole-2,3-dione, 98%. Offered by: Ambeed, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 200mg, 100mg.
5-fluoro-1-methylindole-2,3-dione (CAS 773-91-1) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 5-fluoro-1-methylindole-2,3-dione. InChIKey: VHJRLOILUKMNEY-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-fluoro-1-methylindole-2,3-dione |
| InChIKey | VHJRLOILUKMNEY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)F)C(=O)C1=O |
Computed by PubChem (NCBI)