CAS 3093-97-8 appears in our catalog under these names: 6-Fluoro-1H-indole-2-carboxylic acid, 97%, 97%, 6-Fluoroindole-2-carboxylic acid, 97%, 6-Fluoroindole-2-carboxylic Acid, >98.0%(HPLC)(T), 6-Fluoro-1H-indole-2-carboxylic acid 97%, 6-Fluoro-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat, Combi-blocks, TCI, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 200mg.
6-fluoro-1H-indole-2-carboxylic acid (CAS 3093-97-8) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1H-indole-2-carboxylic acid. InChIKey: LRTIKMXIKAOCDM-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-2-carboxylic acid |
| InChIKey | LRTIKMXIKAOCDM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)