CAS 875305-42-3 appears in our catalog under these names: 6-Fluoro-1h-indole-7-carboxylic acid, 95%, 6-Fluoro-1H-indole-7-carboxylic acid 97%, 6-Fluoro-1H-indole-7-carboxylic acid, 97%, 97%, 6-FLUORO-1H-INDOLE-7-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
6-fluoro-1H-indole-7-carboxylic acid (CAS 875305-42-3) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1H-indole-7-carboxylic acid. InChIKey: YJYWCXSCEPWZIV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-7-carboxylic acid |
| InChIKey | YJYWCXSCEPWZIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)C(=O)O)F |
Computed by PubChem (NCBI)