4-Cyclopropyl-2-fluorobenzoic acid, 98%
cas: 1247927-81-6 — see every product listed under this CAS number, including other names
4-Cyclopropyl-2-fluorobenzoic acid, 98% (CAS 1247927-81-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A621236-250mg |
| cas | 1247927-81-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2389.56 Pln | |
| Ambeed | 5g | 7028.69 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 891.93 Pln | |
| BLDpharm | 1g | 2569.12 Pln | |
| BLDpharm | 5g | 7572.91 Pln | |
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1821.20 Pln | |
| Chemat | 5g | 7067.60 Pln | |
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 500mg | 1492.20 Pln | |
| Fluorochem | 1g | 1924.34 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-cyclopropyl-2-fluorobenzoic acid (CAS 1247927-81-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-cyclopropyl-2-fluorobenzoic acid. InChIKey: UPYZCTDSUYXKBG-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluorobenzoic acid |
| InChIKey | UPYZCTDSUYXKBG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)