4-Cyclopropyl-3-fluoro-2-hydroxybenzaldehyde, 95%
cas: 1628750-60-6 — see every product listed under this CAS number, including other names
4-Cyclopropyl-3-fluoro-2-hydroxybenzaldehyde, 95% (CAS 1628750-60-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1097844-100mg |
| cas | 1628750-60-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1138.00 Pln | |
| Ambeed | 250mg | 1599.69 Pln | |
| Ambeed | 1g | 3151.62 Pln | |
| BLDpharm | 50mg | 836.40 Pln | |
| BLDpharm | 100mg | 1225.15 Pln | |
| BLDpharm | 250mg | 1719.42 Pln | |
| BLDpharm | 1g | 3391.05 Pln | |
| Chemat | 50mg | 659.60 Pln | |
| Chemat | 100mg | 938.00 Pln | |
| Chemat | 250mg | 1374.80 Pln | |
| Chemat | 1g | 2685.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-cyclopropyl-3-fluoro-2-hydroxybenzaldehyde (CAS 1628750-60-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-cyclopropyl-3-fluoro-2-hydroxybenzaldehyde. InChIKey: QEOGPTYDLCRKKN-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-cyclopropyl-3-fluoro-2-hydroxybenzaldehyde |
| InChIKey | QEOGPTYDLCRKKN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=C(C=C2)C=O)O)F |
Computed by PubChem (NCBI)