cas: 76274-94-7 — see every product listed under this CAS number, including other names
4-Cyclopropylbenzoyl chloride, 97% (CAS 76274-94-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A820966-1g |
| cas | 76274-94-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 9040.78 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-cyclopropylbenzoyl chloride (CAS 76274-94-7) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 4-cyclopropylbenzoyl chloride. InChIKey: PFLSDXYKTMMDEA-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 4-cyclopropylbenzoyl chloride |
| InChIKey | PFLSDXYKTMMDEA-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)