cas: 94602-04-7 — see every product listed under this CAS number, including other names
4-Ethoxy-3-nitropyridine hydrochloride, ≥98%, ≥98% (CAS 94602-04-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LB6-5g |
| cas | 94602-04-7 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 381.20 Pln | |
| Chemat | 25g | 1173.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
4-ethoxy-3-nitropyridine;hydrochloride (CAS 94602-04-7) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: 4-ethoxy-3-nitropyridine;hydrochloride. InChIKey: HNMWMLXQJBWURC-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 4-ethoxy-3-nitropyridine;hydrochloride |
| InChIKey | HNMWMLXQJBWURC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=NC=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)