cas: 103440-95-5 — see every product listed under this CAS number, including other names
4-Ethyl-3-nitrobenzoic acid 98% (CAS 103440-95-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208368-1g |
| cas | 103440-95-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 743.06 Pln | |
| Ambeed | 500g | 3418.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208368 |
4-ethyl-3-nitrobenzoic acid (CAS 103440-95-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4-ethyl-3-nitrobenzoic acid. InChIKey: DUTYVLOGZGRKMA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4-ethyl-3-nitrobenzoic acid |
| InChIKey | DUTYVLOGZGRKMA-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)