Products 103440-95-5
CAS 103440-95-5 appears in our catalog under these names: 4-Ethyl-3-nitrobenzoic acid, 95%, 4-Ethyl-3-nitrobenzoic Acid, >95% (HPLC), 4–Ethyl–3–nitrobenzoic acid, 4-Ethyl-3-nitrobenzoic acid, 98%, 98%, 4-Ethyl-3-nitrobenzoic acid, 98%. Offered by: Fluorochem, TRC, GLPBio, Chemat, Ambeed. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 500mg, 50g, 500g.
4-ethyl-3-nitrobenzoic acid (CAS 103440-95-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4-ethyl-3-nitrobenzoic acid. InChIKey: DUTYVLOGZGRKMA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4-ethyl-3-nitrobenzoic acid |
| InChIKey | DUTYVLOGZGRKMA-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)