Products 218608-73-2
CAS 218608-73-2 is the registry number for 4-Ethynyl-N,N-bis(4-methoxyphenyl)aniline, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg.
4-ethynyl-N,N-bis(4-methoxyphenyl)aniline (CAS 218608-73-2) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: 4-ethynyl-N,N-bis(4-methoxyphenyl)aniline. InChIKey: AAVLIJJJYQFWDO-UHFFFAOYSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-ethynyl-N,N-bis(4-methoxyphenyl)aniline |
| InChIKey | AAVLIJJJYQFWDO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(C2=CC=C(C=C2)C#C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)