cas: 908600-72-6 — see every product listed under this CAS number, including other names
4-Fluoro-1H-Indole-5-Carboxylic Acid, 95%, 95% (CAS 908600-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGBD-100mg |
| cas | 908600-72-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 500mg | 1182.80 Pln | |
| Chemat | 1g | 2066.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-1H-indole-5-carboxylic acid (CAS 908600-72-6) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 4-fluoro-1H-indole-5-carboxylic acid. InChIKey: ZXISWOXQFGXSET-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-fluoro-1H-indole-5-carboxylic acid |
| InChIKey | ZXISWOXQFGXSET-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C(=C1C(=O)O)F |
Computed by PubChem (NCBI)