CAS 206860-48-2 appears in our catalog under these names: 4–Fluoro–2–(trifluoromethyl)benzyl bromide, 4-Fluoro-2-(trifluoromethyl)benzyl bromide, 4-Fluoro-2-(trifluoromethyl)benzyl bromide, 98%, 4-Fluoro-2-(trifluoromethyl)benzyl bromide, ≥98%, 4-Fluoro-2-(trifluoromethyl)benzyl Bromide, >97.0%(GC). Offered by: GLPBio, Biosynth, AmBeed, Thermo Scientific (Acros), Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g, 250mg.
1-(bromomethyl)-4-fluoro-2-(trifluoromethyl)benzene (CAS 206860-48-2) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-(bromomethyl)-4-fluoro-2-(trifluoromethyl)benzene. InChIKey: JMNOONULDANZRZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-(bromomethyl)-4-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | JMNOONULDANZRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)CBr |
Computed by PubChem (NCBI)