cas: 1228829-13-7 — see every product listed under this CAS number, including other names
4-Formyl-2,6-dimethylphenylboronic acid, 98% (CAS 1228829-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627915-100MG |
| cas | 1228829-13-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 1g | 1263.11 Pln | |
| Fluorochem | 5g | 4246.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-formyl-2,6-dimethylphenyl)boronic acid (CAS 1228829-13-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,6-dimethylphenyl)boronic acid. InChIKey: MGJJTEKBMONTCP-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,6-dimethylphenyl)boronic acid |
| InChIKey | MGJJTEKBMONTCP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C=O)C)(O)O |
Computed by PubChem (NCBI)