CAS 40990-52-1 appears in our catalog under these names: 4-Hydroxy-6-indolecarboxylic acid, 95%, 4-Hydroxy-1H-indole-6-carboxylic acid, 95%, 95%, 4-Hydroxy-1H-indole-6-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-hydroxy-1H-indole-6-carboxylic acid (CAS 40990-52-1) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 4-hydroxy-1H-indole-6-carboxylic acid. InChIKey: TXZOAKBAZXCPGT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-hydroxy-1H-indole-6-carboxylic acid |
| InChIKey | TXZOAKBAZXCPGT-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=CC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)