cas: 74230-08-3 — see every product listed under this CAS number, including other names
4-Hydroxy-2-nitrobenzoic acid, 95%, 95% (CAS 74230-08-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116YPN-1g |
| cas | 74230-08-3 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1024.40 Pln | |
| Chemat | 5g | 3477.20 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 371.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-hydroxy-2-nitrobenzoic acid (CAS 74230-08-3) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 4-hydroxy-2-nitrobenzoic acid. InChIKey: FNDZIIJCKXGZJA-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 4-hydroxy-2-nitrobenzoic acid |
| InChIKey | FNDZIIJCKXGZJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)