4-Iodo-2,3-difluorobenzoic acid, 97%, 97%
cas: 501433-05-2 — see every product listed under this CAS number, including other names
4-Iodo-2,3-difluorobenzoic acid, 97%, 97% (CAS 501433-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9EX-100mg |
| cas | 501433-05-2 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1389.20 Pln | |
| Chemat | 10g | 2186.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3-difluoro-4-iodobenzoic acid (CAS 501433-05-2) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 2,3-difluoro-4-iodobenzoic acid. InChIKey: YHWFOSYYOBKIHS-UHFFFAOYSA-N.
| Molecular formula | C7H3F2IO2 |
|---|---|
| Molecular weight | 284.00 g/mol |
| IUPAC name | 2,3-difluoro-4-iodobenzoic acid |
| InChIKey | YHWFOSYYOBKIHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)I |
Computed by PubChem (NCBI)