Products 663934-17-6
CAS 663934-17-6 is the registry number for 2,2-difluoro-5-iodobenzo[d][1,3]dioxole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,2-difluoro-5-iodo-1,3-benzodioxole (CAS 663934-17-6) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 2,2-difluoro-5-iodo-1,3-benzodioxole. InChIKey: UXDJLBBFLAUBGS-UHFFFAOYSA-N.
| Molecular formula | C7H3F2IO2 |
|---|---|
| Molecular weight | 284.00 g/mol |
| IUPAC name | 2,2-difluoro-5-iodo-1,3-benzodioxole |
| InChIKey | UXDJLBBFLAUBGS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)OC(O2)(F)F |
Computed by PubChem (NCBI)