CAS 333780-74-8 appears in our catalog under these names: 2,3-Difluoro-5-iodobenzoic acid, 96%, 2,3-difluoro-5-iodobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
2,3-difluoro-5-iodobenzoic acid (CAS 333780-74-8) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 2,3-difluoro-5-iodobenzoic acid. InChIKey: HMKVHQOVPZBEQU-UHFFFAOYSA-N.
| Molecular formula | C7H3F2IO2 |
|---|---|
| Molecular weight | 284.00 g/mol |
| IUPAC name | 2,3-difluoro-5-iodobenzoic acid |
| InChIKey | HMKVHQOVPZBEQU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)F)I |
Computed by PubChem (NCBI)