Products 173406-69-4

CAS 173406-69-4 is the registry number for 2,4-Difluoro-3-iodobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2,4-difluoro-3-iodobenzoic acid (CAS 173406-69-4) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 2,4-difluoro-3-iodobenzoic acid. InChIKey: FJSKCDWIRWKBJU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F2IO2
Molecular weight284.00 g/mol
IUPAC name2,4-difluoro-3-iodobenzoic acid
InChIKeyFJSKCDWIRWKBJU-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)F)I)F

Computed by PubChem (NCBI)