CAS 333780-75-9 appears in our catalog under these names: 2,3-Difluoro-6-iodobenzoic acid, 95%, 2,3–Difluoro–6–iodobenzoic acid, 2,3-Difluoro-6-iodobenzoic acid 95%, 2,3-Difluoro-6-iodobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 250g.
2,3-difluoro-6-iodobenzoic acid (CAS 333780-75-9) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 2,3-difluoro-6-iodobenzoic acid. InChIKey: RBZFCUDQWRXOLM-UHFFFAOYSA-N.
| Molecular formula | C7H3F2IO2 |
|---|---|
| Molecular weight | 284.00 g/mol |
| IUPAC name | 2,3-difluoro-6-iodobenzoic acid |
| InChIKey | RBZFCUDQWRXOLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(=O)O)I |
Computed by PubChem (NCBI)