CAS 501433-05-2 appears in our catalog under these names: 4-Iodo-2,3-difluorobenzoic acid, 95%, 2,3-Difluoro-4-iodobenzoic acid 97%, 4-Iodo-2,3-difluorobenzoic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
2,3-difluoro-4-iodobenzoic acid (CAS 501433-05-2) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 2,3-difluoro-4-iodobenzoic acid. InChIKey: YHWFOSYYOBKIHS-UHFFFAOYSA-N.
| Molecular formula | C7H3F2IO2 |
|---|---|
| Molecular weight | 284.00 g/mol |
| IUPAC name | 2,3-difluoro-4-iodobenzoic acid |
| InChIKey | YHWFOSYYOBKIHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)I |
Computed by PubChem (NCBI)