Products 658-06-0

CAS 658-06-0 is the registry number for 3,5-Difluoro-4-iodobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,5-difluoro-4-iodobenzoic acid (CAS 658-06-0) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 3,5-difluoro-4-iodobenzoic acid. InChIKey: PELPTVLNQCWMCR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F2IO2
Molecular weight284.00 g/mol
IUPAC name3,5-difluoro-4-iodobenzoic acid
InChIKeyPELPTVLNQCWMCR-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)I)F)C(=O)O

Computed by PubChem (NCBI)