CAS 658-06-0 is the registry number for 3,5-Difluoro-4-iodobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,5-difluoro-4-iodobenzoic acid (CAS 658-06-0) is a chemical compound with the molecular formula C7H3F2IO2 and a molecular weight of 284.00 g/mol. IUPAC name: 3,5-difluoro-4-iodobenzoic acid. InChIKey: PELPTVLNQCWMCR-UHFFFAOYSA-N.
| Molecular formula | C7H3F2IO2 |
|---|---|
| Molecular weight | 284.00 g/mol |
| IUPAC name | 3,5-difluoro-4-iodobenzoic acid |
| InChIKey | PELPTVLNQCWMCR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)I)F)C(=O)O |
Computed by PubChem (NCBI)