cas: 20780-75-0 — see every product listed under this CAS number, including other names
4-Iodoindoline-2,3-dione, 98%, 98% (CAS 20780-75-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JAQ-250mg |
| cas | 20780-75-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 314.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-iodo-1H-indole-2,3-dione (CAS 20780-75-0) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 4-iodo-1H-indole-2,3-dione. InChIKey: NYWOXCHAPWQNFC-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 4-iodo-1H-indole-2,3-dione |
| InChIKey | NYWOXCHAPWQNFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)