cas: 20780-75-0 — see every product listed under this CAS number, including other names
4-Iodoindoline-2,3-dione, 98% (CAS 20780-75-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091652-1G |
| cas | 20780-75-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 497.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-iodo-1H-indole-2,3-dione (CAS 20780-75-0) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 4-iodo-1H-indole-2,3-dione. InChIKey: NYWOXCHAPWQNFC-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 4-iodo-1H-indole-2,3-dione |
| InChIKey | NYWOXCHAPWQNFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)